C19H33N2O5Si — CID 67791181
CID 67791181 (PubChem CID 67791181) has the molecular formula C19H33N2O5Si and a molecular weight of 397.57 g/mol.
| Compound Name | CID 67791181 |
|---|---|
| PubChem CID | 67791181 |
| Molecular Formula | C19H33N2O5Si |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | — |
| SMILES | C=CCOC(=O)N[C@@H]1CN(C(=O)OCC=C)[C@](CO[Si](C)C)(C(C)(C)C)C1 |
| InChI | InChI=1S/C19H33N2O5Si/c1-8-10-24-16(22)20-15-12-19(18(3,4)5,14-26-27(6)7)21(13-15)17(23)25-11-9-2/h8-9,15H,1-2,10-14H2,3-7H3,(H,20,22)/t15-,19+/m0/s1 |
| InChIKey | FCFWTUVHVKZUTL-HNAYVOBHSA-N |
| XLogP | 3.35 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|