About CID 67791181
CID 67791181 (PubChem CID 67791181) has the molecular formula C19H33N2O5Si
and a molecular weight of 397.57 g/mol.
Molecular Properties
| Compound Name | CID 67791181 |
| PubChem CID | 67791181 |
| Molecular Formula | C19H33N2O5Si |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | — |
| SMILES | C=CCOC(=O)N[C@@H]1CN(C(=O)OCC=C)[C@](CO[Si](C)C)(C(C)(C)C)C1 |
| InChI | InChI=1S/C19H33N2O5Si/c1-8-10-24-16(22)20-15-12-19(18(3,4)5,14-26-27(6)7)21(13-15)17(23)25-11-9-2/h8-9,15H,1-2,10-14H2,3-7H3,(H,20,22)/t15-,19+/m0/s1 |
| InChIKey | FCFWTUVHVKZUTL-HNAYVOBHSA-N |
| XLogP | 3.35 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 67791181 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67791181?
The IUPAC name of CID 67791181 (CID 67791181) is not available.
What is the SMILES notation for CID 67791181?
The canonical SMILES for CID 67791181 is C=CCOC(=O)N[C@@H]1CN(C(=O)OCC=C)[C@](CO[Si](C)C)(C(C)(C)C)C1.
What is the InChIKey of CID 67791181?
The InChIKey is FCFWTUVHVKZUTL-HNAYVOBHSA-N. The full InChI is InChI=1S/C19H33N2O5Si/c1-8-10-24-16(22)20-15-12-19(18(3,4)5,14-26-27(6)7)21(13-15)17(23)25-11-9-2/h8-9,15H,1-2,10-14H2,3-7H3,(H,20,22)/t15-,19+/m0/s1.
What are the key properties of CID 67791181?
CID 67791181 has a molecular weight of 397.57 g/mol, XLogP of 3.35, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67791181 is sourced from PubChem (CID 67791181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).