C10H15NO5 — CID 104774851
3-O-methyl 4-O-prop-2-enyl morpholine-3,4-dicarboxylate (PubChem CID 104774851) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is 3-O-methyl 4-O-prop-2-enyl morpholine-3,4-dicarboxylate.
| Compound Name | 3-O-methyl 4-O-prop-2-enyl morpholine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 104774851 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 3-O-methyl 4-O-prop-2-enyl morpholine-3,4-dicarboxylate |
| SMILES | C=CCOC(=O)N1CCOCC1C(=O)OC |
| InChI | InChI=1S/C10H15NO5/c1-3-5-16-10(13)11-4-6-15-7-8(11)9(12)14-2/h3,8H,1,4-7H2,2H3 |
| InChIKey | ZRZKZXHSLAPWHD-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|