C10H15NO4 — CID 106320412
cis-(1R,3S)-3-(prop-2-enoxycarbonylamino)cyclopentane-1-carboxylic acid (PubChem CID 106320412) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is cis-(1R,3S)-3-(prop-2-enoxycarbonylamino)cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-(prop-2-enoxycarbonylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106320412 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | cis-(1R,3S)-3-(prop-2-enoxycarbonylamino)cyclopentane-1-carboxylic acid |
| SMILES | C=CCOC(=O)N[C@H]1CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C10H15NO4/c1-2-5-15-10(14)11-8-4-3-7(6-8)9(12)13/h2,7-8H,1,3-6H2,(H,11,14)(H,12,13)/t7-,8+/m1/s1 |
| InChIKey | NGQXYMWNXYYZBR-SFYZADRCSA-N |
| XLogP | 1.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|