C11H17NO5 — CID 167734768
(1S,2R,4R)-4-hydroxy-2-(prop-2-enoxycarbonylamino)cyclohexane-1-carboxylic acid (PubChem CID 167734768) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is (1S,2R,4R)-4-hydroxy-2-(prop-2-enoxycarbonylamino)cyclohexane-1-carboxylic acid.
| Compound Name | (1S,2R,4R)-4-hydroxy-2-(prop-2-enoxycarbonylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 167734768 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (1S,2R,4R)-4-hydroxy-2-(prop-2-enoxycarbonylamino)cyclohexane-1-carboxylic acid |
| SMILES | C=CCOC(=O)N[C@@H]1C[C@H](O)CC[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H17NO5/c1-2-5-17-11(16)12-9-6-7(13)3-4-8(9)10(14)15/h2,7-9,13H,1,3-6H2,(H,12,16)(H,14,15)/t7-,8+,9-/m1/s1 |
| InChIKey | AGPCHPNWVCBQJH-HRDYMLBCSA-N |
| XLogP | 0.51 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|