C16H24N2O4S — CID 85224532
prop-2-enyl 2-[2-methyl-3-(prop-2-enoxycarbonylamino)prop-1-enyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 85224532) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is prop-2-enyl 2-[2-methyl-3-(prop-2-enoxycarbonylamino)prop-1-enyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl 2-[2-methyl-3-(prop-2-enoxycarbonylamino)prop-1-enyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 85224532 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | prop-2-enyl 2-[2-methyl-3-(prop-2-enoxycarbonylamino)prop-1-enyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)NCC(C)=CC1CC(S)CN1C(=O)OCC=C |
| InChI | InChI=1S/C16H24N2O4S/c1-4-6-21-15(19)17-10-12(3)8-13-9-14(23)11-18(13)16(20)22-7-5-2/h4-5,8,13-14,23H,1-2,6-7,9-11H2,3H3,(H,17,19) |
| InChIKey | GZQWTXYZAJNIAE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|