C12H20N4O4S — CID 135442283
prop-2-enyl (2R,4S)-2-[(2Z)-2-hydroxyimino-2-(methylcarbamoylamino)ethyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 135442283) has the molecular formula C12H20N4O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is prop-2-enyl (2R,4S)-2-[(2Z)-2-hydroxyimino-2-(methylcarbamoylamino)ethyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4S)-2-[(2Z)-2-hydroxyimino-2-(methylcarbamoylamino)ethyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135442283 |
| Molecular Formula | C12H20N4O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | prop-2-enyl (2R,4S)-2-[(2Z)-2-hydroxyimino-2-(methylcarbamoylamino)ethyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](S)C[C@H]1C/C(=N/O)NC(=O)NC |
| InChI | InChI=1S/C12H20N4O4S/c1-3-4-20-12(18)16-7-9(21)5-8(16)6-10(15-19)14-11(17)13-2/h3,8-9,19,21H,1,4-7H2,2H3,(H2,13,14,15,17)/t8-,9-/m0/s1 |
| InChIKey | NFCPPJGERBIFAN-IUCAKERBSA-N |
| XLogP | 0.79 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|