C14H21N3O5S — CID 135533247
prop-2-enyl (2R,4S)-2-[(2Z)-2-hydroxyimino-2-(prop-2-enoxycarbonylamino)ethyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 135533247) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is prop-2-enyl (2R,4S)-2-[(2Z)-2-hydroxyimino-2-(prop-2-enoxycarbonylamino)ethyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4S)-2-[(2Z)-2-hydroxyimino-2-(prop-2-enoxycarbonylamino)ethyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135533247 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | prop-2-enyl (2R,4S)-2-[(2Z)-2-hydroxyimino-2-(prop-2-enoxycarbonylamino)ethyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N/C(C[C@@H]1C[C@H](S)CN1C(=O)OCC=C)=N\O |
| InChI | InChI=1S/C14H21N3O5S/c1-3-5-21-13(18)15-12(16-20)8-10-7-11(23)9-17(10)14(19)22-6-4-2/h3-4,10-11,20,23H,1-2,5-9H2,(H,15,16,18)/t10-,11-/m0/s1 |
| InChIKey | ADVIGUJEVQQHNU-QWRGUYRKSA-N |
| XLogP | 1.77 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|