C24H38N2O7SSi — CID 57003946
prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[3-[(2,3-dihydroxyphenyl)sulfonylamino]-2-methylprop-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 57003946) has the molecular formula C24H38N2O7SSi and a molecular weight of 526.73 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[3-[(2,3-dihydroxyphenyl)sulfonylamino]-2-methylprop-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[3-[(2,3-dihydroxyphenyl)sulfonylamino]-2-methylprop-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57003946 |
| Molecular Formula | C24H38N2O7SSi |
| Molecular Weight | 526.73 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[3-[(2,3-dihydroxyphenyl)sulfonylamino]-2-methylprop-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C=C(C)CNS(=O)(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C24H38N2O7SSi/c1-8-12-32-23(29)26-16-19(33-35(6,7)24(3,4)5)14-18(26)13-17(2)15-25-34(30,31)21-11-9-10-20(27)22(21)28/h8-11,13,18-19,25,27-28H,1,12,14-16H2,2-7H3/t18-,19-/m1/s1 |
| InChIKey | ZQTCAUVRSGVZED-RTBURBONSA-N |
| XLogP | 4.11 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.73 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|