C15H27N3O7S2 — CID 57325278
prop-2-enyl (2S,4R)-2-[2-methyl-3-[methyl(methylsulfamoyl)amino]prop-1-enyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 57325278) has the molecular formula C15H27N3O7S2 and a molecular weight of 425.53 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-2-[2-methyl-3-[methyl(methylsulfamoyl)amino]prop-1-enyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4R)-2-[2-methyl-3-[methyl(methylsulfamoyl)amino]prop-1-enyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57325278 |
| Molecular Formula | C15H27N3O7S2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | prop-2-enyl (2S,4R)-2-[2-methyl-3-[methyl(methylsulfamoyl)amino]prop-1-enyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](OS(C)(=O)=O)C[C@H]1C=C(C)CN(C)S(=O)(=O)NC |
| InChI | InChI=1S/C15H27N3O7S2/c1-6-7-24-15(19)18-11-14(25-26(5,20)21)9-13(18)8-12(2)10-17(4)27(22,23)16-3/h6,8,13-14,16H,1,7,9-11H2,2-5H3/t13-,14-/m1/s1 |
| InChIKey | LAROYXMNNRKSMR-ZIAGYGMSSA-N |
| XLogP | 0.07 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|