C21H37N3O6SSi — CID 173325481
prop-2-enyl (2R,4R)-2-[2-[2-(1-dimethylsilyloxy-2,2-dimethylpropyl)imidazol-1-yl]ethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 173325481) has the molecular formula C21H37N3O6SSi and a molecular weight of 487.70 g/mol. Its IUPAC name is prop-2-enyl (2R,4R)-2-[2-[2-(1-dimethylsilyloxy-2,2-dimethylpropyl)imidazol-1-yl]ethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4R)-2-[2-[2-(1-dimethylsilyloxy-2,2-dimethylpropyl)imidazol-1-yl]ethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173325481 |
| Molecular Formula | C21H37N3O6SSi |
| Molecular Weight | 487.70 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | prop-2-enyl (2R,4R)-2-[2-[2-(1-dimethylsilyloxy-2,2-dimethylpropyl)imidazol-1-yl]ethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](OS(C)(=O)=O)C[C@H]1CCn1ccnc1C(O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C21H37N3O6SSi/c1-8-13-28-20(25)24-15-17(29-31(5,26)27)14-16(24)9-11-23-12-10-22-19(23)18(21(2,3)4)30-32(6)7/h8,10,12,16-18,32H,1,9,11,13-15H2,2-7H3/t16-,17-,18?/m1/s1 |
| InChIKey | XYRKQPPFBPNYQG-OWZOALSMSA-N |
| XLogP | 3.10 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|