C22H24N4O7S — CID 54080198
prop-2-enyl (2R,4R)-2-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 54080198) has the molecular formula C22H24N4O7S and a molecular weight of 488.52 g/mol. Its IUPAC name is prop-2-enyl (2R,4R)-2-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4R)-2-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 54080198 |
| Molecular Formula | C22H24N4O7S |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | prop-2-enyl (2R,4R)-2-[2-[2-(1,3-dioxoisoindol-2-yl)imidazol-1-yl]ethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](OS(C)(=O)=O)C[C@H]1CCn1ccnc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H24N4O7S/c1-3-12-32-22(29)25-14-16(33-34(2,30)31)13-15(25)8-10-24-11-9-23-21(24)26-19(27)17-6-4-5-7-18(17)20(26)28/h3-7,9,11,15-16H,1,8,10,12-14H2,2H3/t15-,16-/m1/s1 |
| InChIKey | MMOGWIYKXZTNJQ-HZPDHXFCSA-N |
| XLogP | 1.82 |
| TPSA | 128.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|