C22H26N4O4S — CID 57246556
prop-2-enyl (2R,4S)-4-benzoylsulfanyl-2-[2-(4-carbamoyl-2-methylimidazol-1-yl)ethyl]pyrrolidine-1-carboxylate (PubChem CID 57246556) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is prop-2-enyl (2R,4S)-4-benzoylsulfanyl-2-[2-(4-carbamoyl-2-methylimidazol-1-yl)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4S)-4-benzoylsulfanyl-2-[2-(4-carbamoyl-2-methylimidazol-1-yl)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57246556 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | prop-2-enyl (2R,4S)-4-benzoylsulfanyl-2-[2-(4-carbamoyl-2-methylimidazol-1-yl)ethyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(=O)c2ccccc2)C[C@H]1CCn1cc(C(N)=O)nc1C |
| InChI | InChI=1S/C22H26N4O4S/c1-3-11-30-22(29)26-13-18(31-21(28)16-7-5-4-6-8-16)12-17(26)9-10-25-14-19(20(23)27)24-15(25)2/h3-8,14,17-18H,1,9-13H2,2H3,(H2,23,27)/t17-,18+/m1/s1 |
| InChIKey | AQKHZSMOIBRMAY-MSOLQXFVSA-N |
| XLogP | 3.02 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|