C21H21N3O3S2 — CID 86756324
prop-2-enyl (2R,4S)-4-benzoylsulfanyl-2-(imidazo[5,1-b][1,3]thiazol-7-ylmethyl)pyrrolidine-1-carboxylate (PubChem CID 86756324) has the molecular formula C21H21N3O3S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is prop-2-enyl (2R,4S)-4-benzoylsulfanyl-2-(imidazo[5,1-b][1,3]thiazol-7-ylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4S)-4-benzoylsulfanyl-2-(imidazo[5,1-b][1,3]thiazol-7-ylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86756324 |
| Molecular Formula | C21H21N3O3S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | prop-2-enyl (2R,4S)-4-benzoylsulfanyl-2-(imidazo[5,1-b][1,3]thiazol-7-ylmethyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(=O)c2ccccc2)C[C@H]1Cc1ncn2ccsc12 |
| InChI | InChI=1S/C21H21N3O3S2/c1-2-9-27-21(26)24-13-17(29-20(25)15-6-4-3-5-7-15)11-16(24)12-18-19-23(14-22-18)8-10-28-19/h2-8,10,14,16-17H,1,9,11-13H2/t16-,17-/m0/s1 |
| InChIKey | VREBEYNYPJMDSK-IRXDYDNUSA-N |
| XLogP | 4.28 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|