C21H22N2O4S — CID 10992999
prop-2-enyl (2S,4S)-4-benzoylsulfanyl-2-[(S)-hydroxy(pyridin-4-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 10992999) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is prop-2-enyl (2S,4S)-4-benzoylsulfanyl-2-[(S)-hydroxy(pyridin-4-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4S)-4-benzoylsulfanyl-2-[(S)-hydroxy(pyridin-4-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10992999 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | prop-2-enyl (2S,4S)-4-benzoylsulfanyl-2-[(S)-hydroxy(pyridin-4-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(=O)c2ccccc2)C[C@H]1[C@@H](O)c1ccncc1 |
| InChI | InChI=1S/C21H22N2O4S/c1-2-12-27-21(26)23-14-17(28-20(25)16-6-4-3-5-7-16)13-18(23)19(24)15-8-10-22-11-9-15/h2-11,17-19,24H,1,12-14H2/t17-,18-,19-/m0/s1 |
| InChIKey | LHJZDDRVNCBVMJ-FHWLQOOXSA-N |
| XLogP | 3.45 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|