C27H25NO4S — CID 123354705
methyl 4-benzoylsulfanyl-1-(2,2-diphenylacetyl)pyrrolidine-2-carboxylate (PubChem CID 123354705) has the molecular formula C27H25NO4S and a molecular weight of 459.57 g/mol. Its IUPAC name is methyl 4-benzoylsulfanyl-1-(2,2-diphenylacetyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-benzoylsulfanyl-1-(2,2-diphenylacetyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 123354705 |
| Molecular Formula | C27H25NO4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | methyl 4-benzoylsulfanyl-1-(2,2-diphenylacetyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(SC(=O)c2ccccc2)CN1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25NO4S/c1-32-26(30)23-17-22(33-27(31)21-15-9-4-10-16-21)18-28(23)25(29)24(19-11-5-2-6-12-19)20-13-7-3-8-14-20/h2-16,22-24H,17-18H2,1H3 |
| InChIKey | JOXHCEANXXCHHL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|