C22H27NO4 — CID 145121615
ethane;methyl 1-(2,2-diphenylacetyl)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 145121615) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is ethane;methyl 1-(2,2-diphenylacetyl)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | ethane;methyl 1-(2,2-diphenylacetyl)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 145121615 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | ethane;methyl 1-(2,2-diphenylacetyl)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | CC.COC(=O)C1CC(O)CN1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21NO4.C2H6/c1-25-20(24)17-12-16(22)13-21(17)19(23)18(14-8-4-2-5-9-14)15-10-6-3-7-11-15;1-2/h2-11,16-18,22H,12-13H2,1H3;1-2H3 |
| InChIKey | BNMOIRUPHKBOMH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |