C31H36N2O3 — CID 123610016
methyl 1-(2,2-diphenylacetyl)-4-[methyl(4-phenylbutyl)amino]pyrrolidine-2-carboxylate (PubChem CID 123610016) has the molecular formula C31H36N2O3 and a molecular weight of 484.64 g/mol. Its IUPAC name is methyl 1-(2,2-diphenylacetyl)-4-[methyl(4-phenylbutyl)amino]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(2,2-diphenylacetyl)-4-[methyl(4-phenylbutyl)amino]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 123610016 |
| Molecular Formula | C31H36N2O3 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | methyl 1-(2,2-diphenylacetyl)-4-[methyl(4-phenylbutyl)amino]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(N(C)CCCCc2ccccc2)CN1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H36N2O3/c1-32(21-13-12-16-24-14-6-3-7-15-24)27-22-28(31(35)36-2)33(23-27)30(34)29(25-17-8-4-9-18-25)26-19-10-5-11-20-26/h3-11,14-15,17-20,27-29H,12-13,16,21-23H2,1-2H3 |
| InChIKey | DRFAAZAYUNDORY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|