C15H19NO4 — CID 54060167
dimethyl (2R,4S)-1-(1-phenylethyl)azetidine-2,4-dicarboxylate (PubChem CID 54060167) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is dimethyl (2R,4S)-1-(1-phenylethyl)azetidine-2,4-dicarboxylate.
| Compound Name | dimethyl (2R,4S)-1-(1-phenylethyl)azetidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 54060167 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | dimethyl (2R,4S)-1-(1-phenylethyl)azetidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](C(=O)OC)N1C(C)c1ccccc1 |
| InChI | InChI=1S/C15H19NO4/c1-10(11-7-5-4-6-8-11)16-12(14(17)19-2)9-13(16)15(18)20-3/h4-8,10,12-13H,9H2,1-3H3/t10?,12-,13+ |
| InChIKey | LZCXQRHRFFDCNB-VGPLMAKISA-N |
| XLogP | 1.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |