C21H24N4O4S — CID 57258433
prop-2-enyl (2R,4S)-4-benzoylsulfanyl-2-[2-(2-carbamoylimidazol-1-yl)ethyl]pyrrolidine-1-carboxylate (PubChem CID 57258433) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is prop-2-enyl (2R,4S)-4-benzoylsulfanyl-2-[2-(2-carbamoylimidazol-1-yl)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4S)-4-benzoylsulfanyl-2-[2-(2-carbamoylimidazol-1-yl)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57258433 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | prop-2-enyl (2R,4S)-4-benzoylsulfanyl-2-[2-(2-carbamoylimidazol-1-yl)ethyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(=O)c2ccccc2)C[C@H]1CCn1ccnc1C(N)=O |
| InChI | InChI=1S/C21H24N4O4S/c1-2-12-29-21(28)25-14-17(30-20(27)15-6-4-3-5-7-15)13-16(25)8-10-24-11-9-23-19(24)18(22)26/h2-7,9,11,16-17H,1,8,10,12-14H2,(H2,22,26)/t16-,17+/m1/s1 |
| InChIKey | MXMJYJAQFDZXLA-SJORKVTESA-N |
| XLogP | 2.71 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|