C13H19N3O3 — CID 19971456
prop-2-enyl 4-hydroxy-2-(2-imidazol-1-ylethyl)pyrrolidine-1-carboxylate (PubChem CID 19971456) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is prop-2-enyl 4-hydroxy-2-(2-imidazol-1-ylethyl)pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl 4-hydroxy-2-(2-imidazol-1-ylethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 19971456 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | prop-2-enyl 4-hydroxy-2-(2-imidazol-1-ylethyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC(O)CC1CCn1ccnc1 |
| InChI | InChI=1S/C13H19N3O3/c1-2-7-19-13(18)16-9-12(17)8-11(16)3-5-15-6-4-14-10-15/h2,4,6,10-12,17H,1,3,5,7-9H2 |
| InChIKey | NWQLHXNMRVAIKD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|