C14H21N3O3 — CID 56980657
prop-2-enyl (2R,4R)-4-hydroxy-2-[(2S)-2-imidazol-1-ylpropyl]pyrrolidine-1-carboxylate (PubChem CID 56980657) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is prop-2-enyl (2R,4R)-4-hydroxy-2-[(2S)-2-imidazol-1-ylpropyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4R)-4-hydroxy-2-[(2S)-2-imidazol-1-ylpropyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 56980657 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | prop-2-enyl (2R,4R)-4-hydroxy-2-[(2S)-2-imidazol-1-ylpropyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O)C[C@H]1C[C@H](C)n1ccnc1 |
| InChI | InChI=1S/C14H21N3O3/c1-3-6-20-14(19)17-9-13(18)8-12(17)7-11(2)16-5-4-15-10-16/h3-5,10-13,18H,1,6-9H2,2H3/t11-,12+,13+/m0/s1 |
| InChIKey | DDNVUMPGBIWCTF-YNEHKIRRSA-N |
| XLogP | 1.59 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|