C15H19N3O4 — CID 67752206
prop-2-enyl 2-[(2-carbamoyl-4-pyridinyl)methyl]-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 67752206) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is prop-2-enyl 2-[(2-carbamoyl-4-pyridinyl)methyl]-4-hydroxypyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl 2-[(2-carbamoyl-4-pyridinyl)methyl]-4-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67752206 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | prop-2-enyl 2-[(2-carbamoyl-4-pyridinyl)methyl]-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC(O)CC1Cc1ccnc(C(N)=O)c1 |
| InChI | InChI=1S/C15H19N3O4/c1-2-5-22-15(21)18-9-12(19)8-11(18)6-10-3-4-17-13(7-10)14(16)20/h2-4,7,11-12,19H,1,5-6,8-9H2,(H2,16,20) |
| InChIKey | LOVQDOQUWDVCEO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|