C20H32N2O4Si — CID 54122586
prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1-oxidopyridin-1-ium-4-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 54122586) has the molecular formula C20H32N2O4Si and a molecular weight of 392.57 g/mol. Its IUPAC name is prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1-oxidopyridin-1-ium-4-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1-oxidopyridin-1-ium-4-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 54122586 |
| Molecular Formula | C20H32N2O4Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(1-oxidopyridin-1-ium-4-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1Cc1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C20H32N2O4Si/c1-7-12-25-19(23)22-15-18(26-27(5,6)20(2,3)4)14-17(22)13-16-8-10-21(24)11-9-16/h7-11,17-18H,1,12-15H2,2-6H3/t17-,18-/m1/s1 |
| InChIKey | NOTZWQKTRDGCAM-QZTJIDSGSA-N |
| XLogP | 3.65 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|