C20H32N4O3Si — CID 18652162
prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(imidazo[1,2-b]pyrazol-1-ylmethyl)pyrrolidine-1-carboxylate (PubChem CID 18652162) has the molecular formula C20H32N4O3Si and a molecular weight of 404.59 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(imidazo[1,2-b]pyrazol-1-ylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(imidazo[1,2-b]pyrazol-1-ylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18652162 |
| Molecular Formula | C20H32N4O3Si |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(imidazo[1,2-b]pyrazol-1-ylmethyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1Cn1ccn2nccc12 |
| InChI | InChI=1S/C20H32N4O3Si/c1-7-12-26-19(25)23-15-17(27-28(5,6)20(2,3)4)13-16(23)14-22-10-11-24-18(22)8-9-21-24/h7-11,16-17H,1,12-15H2,2-6H3/t16-,17+/m0/s1 |
| InChIKey | QVJFCEWCLSWWBA-DLBZAZTESA-N |
| XLogP | 3.92 |
| TPSA | 61.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|