C18H33NO4Si — CID 67809336
prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-4-hydroxybut-2-en-2-yl]pyrrolidine-1-carboxylate (PubChem CID 67809336) has the molecular formula C18H33NO4Si and a molecular weight of 355.55 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-4-hydroxybut-2-en-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-4-hydroxybut-2-en-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67809336 |
| Molecular Formula | C18H33NO4Si |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | prop-2-enyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-4-hydroxybut-2-en-2-yl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1/C(C)=C\CO |
| InChI | InChI=1S/C18H33NO4Si/c1-8-11-22-17(21)19-13-15(12-16(19)14(2)9-10-20)23-24(6,7)18(3,4)5/h8-9,15-16,20H,1,10-13H2,2-7H3/b14-9-/t15-,16+/m1/s1 |
| InChIKey | JDEDHNWJUORPJV-BRAFPAACSA-N |
| XLogP | 3.71 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|