C15H22N4O6S — CID 54497513
prop-2-enyl (2R,4R)-2-[2-(4-carbamoylimidazol-1-yl)ethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 54497513) has the molecular formula C15H22N4O6S and a molecular weight of 386.43 g/mol. Its IUPAC name is prop-2-enyl (2R,4R)-2-[2-(4-carbamoylimidazol-1-yl)ethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4R)-2-[2-(4-carbamoylimidazol-1-yl)ethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 54497513 |
| Molecular Formula | C15H22N4O6S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | prop-2-enyl (2R,4R)-2-[2-(4-carbamoylimidazol-1-yl)ethyl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](OS(C)(=O)=O)C[C@H]1CCn1cnc(C(N)=O)c1 |
| InChI | InChI=1S/C15H22N4O6S/c1-3-6-24-15(21)19-8-12(25-26(2,22)23)7-11(19)4-5-18-9-13(14(16)20)17-10-18/h3,9-12H,1,4-8H2,2H3,(H2,16,20)/t11-,12-/m1/s1 |
| InChIKey | YADSDEDKVHZVAL-VXGBXAGGSA-N |
| XLogP | 0.11 |
| TPSA | 133.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|