C17H27N3O6S2 — CID 86756329
prop-2-enyl (2S,4R)-2-[2-[[(2-methylpropan-2-yl)oxyamino]methyl]-1,3-thiazol-4-yl]-4-methylsulfonyloxypyrrolidine-1-carboxylate (PubChem CID 86756329) has the molecular formula C17H27N3O6S2 and a molecular weight of 433.55 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-2-[2-[[(2-methylpropan-2-yl)oxyamino]methyl]-1,3-thiazol-4-yl]-4-methylsulfonyloxypyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4R)-2-[2-[[(2-methylpropan-2-yl)oxyamino]methyl]-1,3-thiazol-4-yl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86756329 |
| Molecular Formula | C17H27N3O6S2 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | prop-2-enyl (2S,4R)-2-[2-[[(2-methylpropan-2-yl)oxyamino]methyl]-1,3-thiazol-4-yl]-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](OS(C)(=O)=O)C[C@H]1c1csc(CNOC(C)(C)C)n1 |
| InChI | InChI=1S/C17H27N3O6S2/c1-6-7-24-16(21)20-10-12(25-28(5,22)23)8-14(20)13-11-27-15(19-13)9-18-26-17(2,3)4/h6,11-12,14,18H,1,7-10H2,2-5H3/t12-,14+/m1/s1 |
| InChIKey | GVDPYHCIYIUYRY-OCCSQVGLSA-N |
| XLogP | 2.38 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|