C22H24NO8PS — CID 54327489
2-O-diphenylphosphoryl 1-O-prop-2-enyl 4-methylsulfonyloxypyrrolidine-1,2-dicarboxylate (PubChem CID 54327489) has the molecular formula C22H24NO8PS and a molecular weight of 493.47 g/mol. Its IUPAC name is 2-O-diphenylphosphoryl 1-O-prop-2-enyl 4-methylsulfonyloxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-diphenylphosphoryl 1-O-prop-2-enyl 4-methylsulfonyloxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 54327489 |
| Molecular Formula | C22H24NO8PS |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 2-O-diphenylphosphoryl 1-O-prop-2-enyl 4-methylsulfonyloxypyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCOC(=O)N1CC(OS(C)(=O)=O)CC1C(=O)OP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24NO8PS/c1-3-14-29-22(25)23-16-17(31-33(2,27)28)15-20(23)21(24)30-32(26,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h3-13,17,20H,1,14-16H2,2H3 |
| InChIKey | SVZOKUIOGULXBK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|