About bis(prop-2-enyl) (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate
bis(prop-2-enyl) (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate (PubChem CID 139678210) has the molecular formula C12H17NO5
and a molecular weight of 255.27 g/mol. Its IUPAC name is bis(prop-2-enyl) (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | bis(prop-2-enyl) (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| PubChem CID | 139678210 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | bis(prop-2-enyl) (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCOC(=O)[C@@H]1C[C@@H](O)CN1C(=O)OCC=C |
| InChI | InChI=1S/C12H17NO5/c1-3-5-17-11(15)10-7-9(14)8-13(10)12(16)18-6-4-2/h3-4,9-10,14H,1-2,5-8H2/t9-,10+/m1/s1 |
| InChIKey | RUOWBZUVHSNHFQ-ZJUUUORDSA-N |
| XLogP | 0.47 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(prop-2-enyl) (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(prop-2-enyl) (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate?
The IUPAC name of bis(prop-2-enyl) (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate (CID 139678210) is bis(prop-2-enyl) (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for bis(prop-2-enyl) (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate?
The canonical SMILES for bis(prop-2-enyl) (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate is C=CCOC(=O)[C@@H]1C[C@@H](O)CN1C(=O)OCC=C.
What is the InChIKey of bis(prop-2-enyl) (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate?
The InChIKey is RUOWBZUVHSNHFQ-ZJUUUORDSA-N. The full InChI is InChI=1S/C12H17NO5/c1-3-5-17-11(15)10-7-9(14)8-13(10)12(16)18-6-4-2/h3-4,9-10,14H,1-2,5-8H2/t9-,10+/m1/s1.
What are the key properties of bis(prop-2-enyl) (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate?
bis(prop-2-enyl) (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate has a molecular weight of 255.27 g/mol, XLogP of 0.47, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(prop-2-enyl) (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 139678210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).