C9H12N4O4 — CID 165495284
(2R,4S)-4-azido-1-prop-2-enoxycarbonylpyrrolidine-2-carboxylic acid (PubChem CID 165495284) has the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. Its IUPAC name is (2R,4S)-4-azido-1-prop-2-enoxycarbonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4S)-4-azido-1-prop-2-enoxycarbonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 165495284 |
| Molecular Formula | C9H12N4O4 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | (2R,4S)-4-azido-1-prop-2-enoxycarbonylpyrrolidine-2-carboxylic acid |
| SMILES | C=CCOC(=O)N1C[C@@H](N=[N+]=[N-])C[C@@H]1C(=O)O |
| InChI | InChI=1S/C9H12N4O4/c1-2-3-17-9(16)13-5-6(11-12-10)4-7(13)8(14)15/h2,6-7H,1,3-5H2,(H,14,15)/t6-,7+/m0/s1 |
| InChIKey | YTPSHGHIKMDZFP-NKWVEPMBSA-N |
| XLogP | 1.15 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|