C6H8N4O4 — CID 90986921
(2R,4R)-4-azidopyrrolidine-1,2-dicarboxylic acid (PubChem CID 90986921) has the molecular formula C6H8N4O4 and a molecular weight of 200.15 g/mol. Its IUPAC name is (2R,4R)-4-azidopyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2R,4R)-4-azidopyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 90986921 |
| Molecular Formula | C6H8N4O4 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | (2R,4R)-4-azidopyrrolidine-1,2-dicarboxylic acid |
| SMILES | [N-]=[N+]=N[C@@H]1C[C@H](C(=O)O)N(C(=O)O)C1 |
| InChI | InChI=1S/C6H8N4O4/c7-9-8-3-1-4(5(11)12)10(2-3)6(13)14/h3-4H,1-2H2,(H,11,12)(H,13,14)/t3-,4-/m1/s1 |
| InChIKey | WQBOWGPMMLEVOY-QWWZWVQMSA-N |
| XLogP | 0.50 |
| TPSA | 126.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|