C8H15N5O2 — CID 155212930
(2S,4R)-4-azido-2-[(dimethylamino)methyl]pyrrolidine-1-carboxylic acid (PubChem CID 155212930) has the molecular formula C8H15N5O2 and a molecular weight of 213.24 g/mol. Its IUPAC name is (2S,4R)-4-azido-2-[(dimethylamino)methyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2S,4R)-4-azido-2-[(dimethylamino)methyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 155212930 |
| Molecular Formula | C8H15N5O2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | (2S,4R)-4-azido-2-[(dimethylamino)methyl]pyrrolidine-1-carboxylic acid |
| SMILES | CN(C)C[C@@H]1C[C@@H](N=[N+]=[N-])CN1C(=O)O |
| InChI | InChI=1S/C8H15N5O2/c1-12(2)5-7-3-6(10-11-9)4-13(7)8(14)15/h6-7H,3-5H2,1-2H3,(H,14,15)/t6-,7+/m1/s1 |
| InChIKey | UECZHIVKXQLAJM-RQJHMYQMSA-N |
| XLogP | 0.98 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|