C14H21NO4 — CID 10956492
2-O-(3-methylbut-2-enyl) 1-O-prop-2-enyl (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 10956492) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-O-(3-methylbut-2-enyl) 1-O-prop-2-enyl (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-(3-methylbut-2-enyl) 1-O-prop-2-enyl (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10956492 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-O-(3-methylbut-2-enyl) 1-O-prop-2-enyl (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCOC(=O)N1CCC[C@H]1C(=O)OCC=C(C)C |
| InChI | InChI=1S/C14H21NO4/c1-4-9-19-14(17)15-8-5-6-12(15)13(16)18-10-7-11(2)3/h4,7,12H,1,5-6,8-10H2,2-3H3/t12-/m0/s1 |
| InChIKey | XJFSFPBPZCELMI-LBPRGKRZSA-N |
| XLogP | 2.28 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|