C21H37NO4 — CID 20837282
1-O-(2-methylpropyl) 2-O-undec-10-enyl (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 20837282) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is 1-O-(2-methylpropyl) 2-O-undec-10-enyl (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-(2-methylpropyl) 2-O-undec-10-enyl (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 20837282 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | 1-O-(2-methylpropyl) 2-O-undec-10-enyl (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCCCCCCCCCOC(=O)[C@@H]1CCCN1C(=O)OCC(C)C |
| InChI | InChI=1S/C21H37NO4/c1-4-5-6-7-8-9-10-11-12-16-25-20(23)19-14-13-15-22(19)21(24)26-17-18(2)3/h4,18-19H,1,5-17H2,2-3H3/t19-/m0/s1 |
| InChIKey | QWRSNYYXCNMPSF-IBGZPJMESA-N |
| XLogP | 5.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|