C30H49BN3NaO12 — CID 131719405
sodium tris[[(2S)-1-(2-methylpropoxycarbonyl)pyrrolidine-2-carbonyl]oxy]boranuide (PubChem CID 131719405) has the molecular formula C30H49BN3NaO12 and a molecular weight of 677.53 g/mol. Its IUPAC name is sodium tris[[(2S)-1-(2-methylpropoxycarbonyl)pyrrolidine-2-carbonyl]oxy]boranuide.
| Compound Name | sodium tris[[(2S)-1-(2-methylpropoxycarbonyl)pyrrolidine-2-carbonyl]oxy]boranuide |
|---|---|
| PubChem CID | 131719405 |
| Molecular Formula | C30H49BN3NaO12 |
| Molecular Weight | 677.53 g/mol |
| Exact Mass | 677.33 |
| IUPAC Name | sodium tris[[(2S)-1-(2-methylpropoxycarbonyl)pyrrolidine-2-carbonyl]oxy]boranuide |
| SMILES | CC(C)COC(=O)N1CCC[C@H]1C(=O)O[BH-](OC(=O)[C@@H]1CCCN1C(=O)OCC(C)C)OC(=O)[C@@H]1CCCN1C(=O)OCC(C)C.[Na+] |
| InChI | InChI=1S/C30H49BN3O12.Na/c1-19(2)16-41-28(38)32-13-7-10-22(32)25(35)44-31(45-26(36)23-11-8-14-33(23)29(39)42-17-20(3)4)46-27(37)24-12-9-15-34(24)30(40)43-18-21(5)6;/h19-24,31H,7-18H2,1-6H3;/q-1;+1/t22-,23-,24-;/m0./s1 |
| InChIKey | KHPJWJFNVZUTLW-NYTZCTPBSA-N |
| XLogP | 0.11 |
| TPSA | 167.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.53 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|