C12H18Cl3NO4 — CID 20837566
2-O-(2-methylpropyl) 1-O-(2,2,2-trichloroethyl) (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 20837566) has the molecular formula C12H18Cl3NO4 and a molecular weight of 346.64 g/mol. Its IUPAC name is 2-O-(2-methylpropyl) 1-O-(2,2,2-trichloroethyl) (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-(2-methylpropyl) 1-O-(2,2,2-trichloroethyl) (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 20837566 |
| Molecular Formula | C12H18Cl3NO4 |
| Molecular Weight | 346.64 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 2-O-(2-methylpropyl) 1-O-(2,2,2-trichloroethyl) (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)COC(=O)[C@@H]1CCCN1C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H18Cl3NO4/c1-8(2)6-19-10(17)9-4-3-5-16(9)11(18)20-7-12(13,14)15/h8-9H,3-7H2,1-2H3/t9-/m0/s1 |
| InChIKey | BWZGFVOXGSPMKS-VIFPVBQESA-N |
| XLogP | 3.16 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.64 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|