C17H23NO3 — CID 100995685
2-methylpropyl 1-benzoylpiperidine-2-carboxylate (PubChem CID 100995685) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-methylpropyl 1-benzoylpiperidine-2-carboxylate.
| Compound Name | 2-methylpropyl 1-benzoylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 100995685 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-methylpropyl 1-benzoylpiperidine-2-carboxylate |
| SMILES | CC(C)COC(=O)C1CCCCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H23NO3/c1-13(2)12-21-17(20)15-10-6-7-11-18(15)16(19)14-8-4-3-5-9-14/h3-5,8-9,13,15H,6-7,10-12H2,1-2H3 |
| InChIKey | VNENRVSQGALDQV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |