About 1-naphthalen-1-ylethyl (2S)-1-benzoylpyrrolidine-2-carboxylate
1-naphthalen-1-ylethyl (2S)-1-benzoylpyrrolidine-2-carboxylate (PubChem CID 10948739) has the molecular formula C24H23NO3
and a molecular weight of 373.45 g/mol. Its IUPAC name is 1-naphthalen-1-ylethyl (2S)-1-benzoylpyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | 1-naphthalen-1-ylethyl (2S)-1-benzoylpyrrolidine-2-carboxylate |
| PubChem CID | 10948739 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 1-naphthalen-1-ylethyl (2S)-1-benzoylpyrrolidine-2-carboxylate |
| SMILES | CC(OC(=O)[C@@H]1CCCN1C(=O)c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H23NO3/c1-17(20-14-7-12-18-9-5-6-13-21(18)20)28-24(27)22-15-8-16-25(22)23(26)19-10-3-2-4-11-19/h2-7,9-14,17,22H,8,15-16H2,1H3/t17?,22-/m0/s1 |
| InChIKey | ZWORLYLXTKHBAV-UGNFMNBCSA-N |
| XLogP | 4.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-naphthalen-1-ylethyl (2S)-1-benzoylpyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-naphthalen-1-ylethyl (2S)-1-benzoylpyrrolidine-2-carboxylate?
The IUPAC name of 1-naphthalen-1-ylethyl (2S)-1-benzoylpyrrolidine-2-carboxylate (CID 10948739) is 1-naphthalen-1-ylethyl (2S)-1-benzoylpyrrolidine-2-carboxylate.
What is the SMILES notation for 1-naphthalen-1-ylethyl (2S)-1-benzoylpyrrolidine-2-carboxylate?
The canonical SMILES for 1-naphthalen-1-ylethyl (2S)-1-benzoylpyrrolidine-2-carboxylate is CC(OC(=O)[C@@H]1CCCN1C(=O)c1ccccc1)c1cccc2ccccc12.
What is the InChIKey of 1-naphthalen-1-ylethyl (2S)-1-benzoylpyrrolidine-2-carboxylate?
The InChIKey is ZWORLYLXTKHBAV-UGNFMNBCSA-N. The full InChI is InChI=1S/C24H23NO3/c1-17(20-14-7-12-18-9-5-6-13-21(18)20)28-24(27)22-15-8-16-25(22)23(26)19-10-3-2-4-11-19/h2-7,9-14,17,22H,8,15-16H2,1H3/t17?,22-/m0/s1.
What are the key properties of 1-naphthalen-1-ylethyl (2S)-1-benzoylpyrrolidine-2-carboxylate?
1-naphthalen-1-ylethyl (2S)-1-benzoylpyrrolidine-2-carboxylate has a molecular weight of 373.45 g/mol, XLogP of 4.75, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-naphthalen-1-ylethyl (2S)-1-benzoylpyrrolidine-2-carboxylate is sourced from PubChem (CID 10948739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).