C19H19N3O3 — CID 610761
methyl 1-(4-phenyldiazenylbenzoyl)pyrrolidine-2-carboxylate (PubChem CID 610761) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is methyl 1-(4-phenyldiazenylbenzoyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(4-phenyldiazenylbenzoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 610761 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | methyl 1-(4-phenyldiazenylbenzoyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(=O)c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-25-19(24)17-8-5-13-22(17)18(23)14-9-11-16(12-10-14)21-20-15-6-3-2-4-7-15/h2-4,6-7,9-12,17H,5,8,13H2,1H3/b21-20+ |
| InChIKey | NOLWBKDVRJXZJR-QZQOTICOSA-N |
| XLogP | 3.88 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|