C21H24N4O3 — CID 15538845
methyl (2S)-1-[3-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]pyrrolidine-2-carboxylate (PubChem CID 15538845) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is methyl (2S)-1-[3-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[3-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 15538845 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | methyl (2S)-1-[3-[[4-(dimethylamino)phenyl]diazenyl]benzoyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)c1cccc(/N=N/c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C21H24N4O3/c1-24(2)18-11-9-16(10-12-18)22-23-17-7-4-6-15(14-17)20(26)25-13-5-8-19(25)21(27)28-3/h4,6-7,9-12,14,19H,5,8,13H2,1-3H3/b23-22+/t19-/m0/s1 |
| InChIKey | LYMNJEKCFAIFCC-CWJYSFMFSA-N |
| XLogP | 3.95 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|