C13H21NO5 — CID 86592536
3-O-ethyl 1-O-prop-2-enyl (6S)-4-hydroxy-6-methylpiperidine-1,3-dicarboxylate (PubChem CID 86592536) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is 3-O-ethyl 1-O-prop-2-enyl (6S)-4-hydroxy-6-methylpiperidine-1,3-dicarboxylate.
| Compound Name | 3-O-ethyl 1-O-prop-2-enyl (6S)-4-hydroxy-6-methylpiperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 86592536 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 3-O-ethyl 1-O-prop-2-enyl (6S)-4-hydroxy-6-methylpiperidine-1,3-dicarboxylate |
| SMILES | C=CCOC(=O)N1CC(C(=O)OCC)C(O)C[C@@H]1C |
| InChI | InChI=1S/C13H21NO5/c1-4-6-19-13(17)14-8-10(12(16)18-5-2)11(15)7-9(14)3/h4,9-11,15H,1,5-8H2,2-3H3/t9-,10?,11?/m0/s1 |
| InChIKey | PFZYQILXVTXPPG-WHXUTIOJSA-N |
| XLogP | 0.94 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|