C13H23NO4 — CID 143394150
tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate (PubChem CID 143394150) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate.
| Compound Name | tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 143394150 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate |
| SMILES | C=CC1CC1C(=O)OCC.CC(C)(C)OC(N)=O |
| InChI | InChI=1S/C8H12O2.C5H11NO2/c1-3-6-5-7(6)8(9)10-4-2;1-5(2,3)8-4(6)7/h3,6-7H,1,4-5H2,2H3;1-3H3,(H2,6,7) |
| InChIKey | HIONTGAUYOCPHP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|