About tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate
tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate (PubChem CID 143394150) has the molecular formula C13H23NO4
and a molecular weight of 257.33 g/mol. Its IUPAC name is tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate |
| PubChem CID | 143394150 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate |
| SMILES | C=CC1CC1C(=O)OCC.CC(C)(C)OC(N)=O |
| InChI | InChI=1S/C8H12O2.C5H11NO2/c1-3-6-5-7(6)8(9)10-4-2;1-5(2,3)8-4(6)7/h3,6-7H,1,4-5H2,2H3;1-3H3,(H2,6,7) |
| InChIKey | HIONTGAUYOCPHP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate?
The IUPAC name of tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate (CID 143394150) is tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate.
What is the SMILES notation for tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate?
The canonical SMILES for tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate is C=CC1CC1C(=O)OCC.CC(C)(C)OC(N)=O.
What is the InChIKey of tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate?
The InChIKey is HIONTGAUYOCPHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2.C5H11NO2/c1-3-6-5-7(6)8(9)10-4-2;1-5(2,3)8-4(6)7/h3,6-7H,1,4-5H2,2H3;1-3H3,(H2,6,7).
What are the key properties of tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate?
tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate has a molecular weight of 257.33 g/mol, XLogP of 2.25, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl carbamate;ethyl 2-ethenylcyclopropane-1-carboxylate is sourced from PubChem (CID 143394150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).