About 2-ethenylcyclopropane-1-carboxylic acid;2-sulfanylpropan-2-yl carbamate
2-ethenylcyclopropane-1-carboxylic acid;2-sulfanylpropan-2-yl carbamate (PubChem CID 142833720) has the molecular formula C10H17NO4S
and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-ethenylcyclopropane-1-carboxylic acid;2-sulfanylpropan-2-yl carbamate.
Molecular Properties
| Compound Name | 2-ethenylcyclopropane-1-carboxylic acid;2-sulfanylpropan-2-yl carbamate |
| PubChem CID | 142833720 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-ethenylcyclopropane-1-carboxylic acid;2-sulfanylpropan-2-yl carbamate |
| SMILES | C=CC1CC1C(=O)O.CC(C)(S)OC(N)=O |
| InChI | InChI=1S/C6H8O2.C4H9NO2S/c1-2-4-3-5(4)6(7)8;1-4(2,8)7-3(5)6/h2,4-5H,1,3H2,(H,7,8);8H,1-2H3,(H2,5,6) |
| InChIKey | NLXVCHFNDOQMTI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenylcyclopropane-1-carboxylic acid;2-sulfanylpropan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylcyclopropane-1-carboxylic acid;2-sulfanylpropan-2-yl carbamate?
The IUPAC name of 2-ethenylcyclopropane-1-carboxylic acid;2-sulfanylpropan-2-yl carbamate (CID 142833720) is 2-ethenylcyclopropane-1-carboxylic acid;2-sulfanylpropan-2-yl carbamate.
What is the SMILES notation for 2-ethenylcyclopropane-1-carboxylic acid;2-sulfanylpropan-2-yl carbamate?
The canonical SMILES for 2-ethenylcyclopropane-1-carboxylic acid;2-sulfanylpropan-2-yl carbamate is C=CC1CC1C(=O)O.CC(C)(S)OC(N)=O.
What is the InChIKey of 2-ethenylcyclopropane-1-carboxylic acid;2-sulfanylpropan-2-yl carbamate?
The InChIKey is NLXVCHFNDOQMTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2.C4H9NO2S/c1-2-4-3-5(4)6(7)8;1-4(2,8)7-3(5)6/h2,4-5H,1,3H2,(H,7,8);8H,1-2H3,(H2,5,6).
What are the key properties of 2-ethenylcyclopropane-1-carboxylic acid;2-sulfanylpropan-2-yl carbamate?
2-ethenylcyclopropane-1-carboxylic acid;2-sulfanylpropan-2-yl carbamate has a molecular weight of 247.32 g/mol, XLogP of 1.64, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylcyclopropane-1-carboxylic acid;2-sulfanylpropan-2-yl carbamate is sourced from PubChem (CID 142833720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).