C22H35NO6 — CID 162414547
ethyl (1S,2S,3S,5R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3,5-bis(ethenyl)cyclopentane-1-carboxylate (PubChem CID 162414547) has the molecular formula C22H35NO6 and a molecular weight of 409.52 g/mol. Its IUPAC name is ethyl (1S,2S,3S,5R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3,5-bis(ethenyl)cyclopentane-1-carboxylate.
| Compound Name | ethyl (1S,2S,3S,5R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3,5-bis(ethenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 162414547 |
| Molecular Formula | C22H35NO6 |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | ethyl (1S,2S,3S,5R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3,5-bis(ethenyl)cyclopentane-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@H](C=C)[C@H](C(=O)OCC)[C@H]1N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35NO6/c1-10-14-13-15(11-2)17(16(14)18(24)27-12-3)23(19(25)28-21(4,5)6)20(26)29-22(7,8)9/h10-11,14-17H,1-2,12-13H2,3-9H3/t14-,15+,16-,17-/m0/s1 |
| InChIKey | WAZDCXMSBJEUGU-YVSFHVDLSA-N |
| XLogP | 4.71 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|