C14H21NO4 — CID 132573847
ethyl (1S,2R,3R,5S)-2-amino-5-ethenyl-3-[(E)-3-methoxy-3-oxoprop-1-enyl]cyclopentane-1-carboxylate (PubChem CID 132573847) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is ethyl (1S,2R,3R,5S)-2-amino-5-ethenyl-3-[(E)-3-methoxy-3-oxoprop-1-enyl]cyclopentane-1-carboxylate.
| Compound Name | ethyl (1S,2R,3R,5S)-2-amino-5-ethenyl-3-[(E)-3-methoxy-3-oxoprop-1-enyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 132573847 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | ethyl (1S,2R,3R,5S)-2-amino-5-ethenyl-3-[(E)-3-methoxy-3-oxoprop-1-enyl]cyclopentane-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@H](/C=C/C(=O)OC)[C@@H](N)[C@H]1C(=O)OCC |
| InChI | InChI=1S/C14H21NO4/c1-4-9-8-10(6-7-11(16)18-3)13(15)12(9)14(17)19-5-2/h4,6-7,9-10,12-13H,1,5,8,15H2,2-3H3/b7-6+/t9-,10+,12+,13-/m1/s1 |
| InChIKey | URUBCMKCNORBLR-CCRZHVNLSA-N |
| XLogP | 1.04 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|