C22H27NO5 — CID 162414542
ethyl (1R,2S,3S,5R)-2-benzamido-3-ethenyl-5-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentane-1-carboxylate (PubChem CID 162414542) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is ethyl (1R,2S,3S,5R)-2-benzamido-3-ethenyl-5-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentane-1-carboxylate.
| Compound Name | ethyl (1R,2S,3S,5R)-2-benzamido-3-ethenyl-5-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 162414542 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | ethyl (1R,2S,3S,5R)-2-benzamido-3-ethenyl-5-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclopentane-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@H](/C=C/C(=O)OCC)[C@@H](C(=O)OCC)[C@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H27NO5/c1-4-15-14-17(12-13-18(24)27-5-2)19(22(26)28-6-3)20(15)23-21(25)16-10-8-7-9-11-16/h4,7-13,15,17,19-20H,1,5-6,14H2,2-3H3,(H,23,25)/b13-12+/t15-,17+,19-,20+/m1/s1 |
| InChIKey | VYTCAQQDTLKRDN-ISQXEUFUSA-N |
| XLogP | 2.91 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|