C31H35NO3 — CID 102202444
ethyl (1S,2R,3S,5R)-2-benzamido-3,5-bis(2-phenylethyl)cyclopentane-1-carboxylate (PubChem CID 102202444) has the molecular formula C31H35NO3 and a molecular weight of 469.62 g/mol. Its IUPAC name is ethyl (1S,2R,3S,5R)-2-benzamido-3,5-bis(2-phenylethyl)cyclopentane-1-carboxylate.
| Compound Name | ethyl (1S,2R,3S,5R)-2-benzamido-3,5-bis(2-phenylethyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 102202444 |
| Molecular Formula | C31H35NO3 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | ethyl (1S,2R,3S,5R)-2-benzamido-3,5-bis(2-phenylethyl)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](CCc2ccccc2)C[C@H](CCc2ccccc2)[C@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H35NO3/c1-2-35-31(34)28-26(20-18-23-12-6-3-7-13-23)22-27(21-19-24-14-8-4-9-15-24)29(28)32-30(33)25-16-10-5-11-17-25/h3-17,26-29H,2,18-22H2,1H3,(H,32,33)/t26-,27+,28+,29-/m1/s1 |
| InChIKey | BUAHDPOVNUGZQT-GIFPIDKJSA-N |
| XLogP | 5.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |