C25H30N2O4S — CID 51424328
ethyl 5-[(2S,3R,4S)-3,4-dibenzamidothiolan-2-yl]pentanoate (PubChem CID 51424328) has the molecular formula C25H30N2O4S and a molecular weight of 454.59 g/mol. Its IUPAC name is ethyl 5-[(2S,3R,4S)-3,4-dibenzamidothiolan-2-yl]pentanoate.
| Compound Name | ethyl 5-[(2S,3R,4S)-3,4-dibenzamidothiolan-2-yl]pentanoate |
|---|---|
| PubChem CID | 51424328 |
| Molecular Formula | C25H30N2O4S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | ethyl 5-[(2S,3R,4S)-3,4-dibenzamidothiolan-2-yl]pentanoate |
| SMILES | CCOC(=O)CCCC[C@@H]1SC[C@@H](NC(=O)c2ccccc2)[C@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H30N2O4S/c1-2-31-22(28)16-10-9-15-21-23(27-25(30)19-13-7-4-8-14-19)20(17-32-21)26-24(29)18-11-5-3-6-12-18/h3-8,11-14,20-21,23H,2,9-10,15-17H2,1H3,(H,26,29)(H,27,30)/t20-,21+,23-/m1/s1 |
| InChIKey | HFZSWRHQZIOJPL-FUPPJEDESA-N |
| XLogP | 3.82 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|