C16H28N2O6S — CID 648351
propyl 5-[3,4-bis(methoxycarbonylamino)thiolan-2-yl]pentanoate (PubChem CID 648351) has the molecular formula C16H28N2O6S and a molecular weight of 376.48 g/mol. Its IUPAC name is propyl 5-[3,4-bis(methoxycarbonylamino)thiolan-2-yl]pentanoate.
| Compound Name | propyl 5-[3,4-bis(methoxycarbonylamino)thiolan-2-yl]pentanoate |
|---|---|
| PubChem CID | 648351 |
| Molecular Formula | C16H28N2O6S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | propyl 5-[3,4-bis(methoxycarbonylamino)thiolan-2-yl]pentanoate |
| SMILES | CCCOC(=O)CCCCC1SCC(NC(=O)OC)C1NC(=O)OC |
| InChI | InChI=1S/C16H28N2O6S/c1-4-9-24-13(19)8-6-5-7-12-14(18-16(21)23-3)11(10-25-12)17-15(20)22-2/h11-12,14H,4-10H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | JVMZMNYGHPNKFU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|