C24H28N2O4S — CID 124716300
methyl 5-[(2S,3R,4R)-3,4-dibenzamidothiolan-2-yl]pentanoate (PubChem CID 124716300) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is methyl 5-[(2S,3R,4R)-3,4-dibenzamidothiolan-2-yl]pentanoate.
| Compound Name | methyl 5-[(2S,3R,4R)-3,4-dibenzamidothiolan-2-yl]pentanoate |
|---|---|
| PubChem CID | 124716300 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | methyl 5-[(2S,3R,4R)-3,4-dibenzamidothiolan-2-yl]pentanoate |
| SMILES | COC(=O)CCCC[C@@H]1SC[C@H](NC(=O)c2ccccc2)[C@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O4S/c1-30-21(27)15-9-8-14-20-22(26-24(29)18-12-6-3-7-13-18)19(16-31-20)25-23(28)17-10-4-2-5-11-17/h2-7,10-13,19-20,22H,8-9,14-16H2,1H3,(H,25,28)(H,26,29)/t19-,20-,22+/m0/s1 |
| InChIKey | RUKOTNUTYIZDQC-JAXLGGSGSA-N |
| XLogP | 3.43 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|